About (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine
(2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine (PubChem CID 143973173) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine |
| PubChem CID | 143973173 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine |
| SMILES | C=CC(F)C(C)/C=C/CN |
| InChI | InChI=1S/C8H14FN/c1-3-8(9)7(2)5-4-6-10/h3-5,7-8H,1,6,10H2,2H3/b5-4+ |
| InChIKey | BRYUEIHNBWYUON-SNAWJCMRSA-N |
| XLogP | 1.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine?
The IUPAC name of (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine (CID 143973173) is (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine.
What is the SMILES notation for (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine?
The canonical SMILES for (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine is C=CC(F)C(C)/C=C/CN.
What is the InChIKey of (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine?
The InChIKey is BRYUEIHNBWYUON-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H14FN/c1-3-8(9)7(2)5-4-6-10/h3-5,7-8H,1,6,10H2,2H3/b5-4+.
What are the key properties of (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine?
(2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine has a molecular weight of 143.20 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5-fluoro-4-methylhepta-2,6-dien-1-amine is sourced from PubChem (CID 143973173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).