C25H30F2N8O2 — CID 143973903
(2S,3E)-2-(1,1-difluoroethyl)-3-ethenyl-2-methoxy-1-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]hexa-3,5-dien-1-one (PubChem CID 143973903) has the molecular formula C25H30F2N8O2 and a molecular weight of 512.57 g/mol. Its IUPAC name is (2S,3E)-2-(1,1-difluoroethyl)-3-ethenyl-2-methoxy-1-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]hexa-3,5-dien-1-one.
| Compound Name | (2S,3E)-2-(1,1-difluoroethyl)-3-ethenyl-2-methoxy-1-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]hexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 143973903 |
| Molecular Formula | C25H30F2N8O2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (2S,3E)-2-(1,1-difluoroethyl)-3-ethenyl-2-methoxy-1-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]hexa-3,5-dien-1-one |
| SMILES | C=C/C=C(\C=C)[C@](OC)(C(=O)N1CCN(c2nc(Nc3cc(C)[nH]n3)c3cccn3n2)CC1)C(C)(F)F |
| InChI | InChI=1S/C25H30F2N8O2/c1-6-9-18(7-2)25(37-5,24(4,26)27)22(36)33-12-14-34(15-13-33)23-29-21(19-10-8-11-35(19)32-23)28-20-16-17(3)30-31-20/h6-11,16H,1-2,12-15H2,3-5H3,(H2,28,29,30,31,32)/b18-9+/t25-/m0/s1 |
| InChIKey | SBBBHGQFMMXLSZ-WAHYLQBZSA-N |
| XLogP | 3.49 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|