C11H22FN3O2 — CID 143974335
4-amino-N-(3-amino-5-methylcyclohexyl)-3-fluoro-2-hydroxybutanamide (PubChem CID 143974335) has the molecular formula C11H22FN3O2 and a molecular weight of 247.31 g/mol. Its IUPAC name is 4-amino-N-(3-amino-5-methylcyclohexyl)-3-fluoro-2-hydroxybutanamide.
| Compound Name | 4-amino-N-(3-amino-5-methylcyclohexyl)-3-fluoro-2-hydroxybutanamide |
|---|---|
| PubChem CID | 143974335 |
| Molecular Formula | C11H22FN3O2 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 4-amino-N-(3-amino-5-methylcyclohexyl)-3-fluoro-2-hydroxybutanamide |
| SMILES | CC1CC(N)CC(NC(=O)C(O)C(F)CN)C1 |
| InChI | InChI=1S/C11H22FN3O2/c1-6-2-7(14)4-8(3-6)15-11(17)10(16)9(12)5-13/h6-10,16H,2-5,13-14H2,1H3,(H,15,17) |
| InChIKey | CTCHYZSSNNABFY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |