C20H18N2O7 — CID 143975031
3-[4-[2-(4-cyanophenyl)-2-oxoethoxy]phenyl]propanoic acid;oxamic acid (PubChem CID 143975031) has the molecular formula C20H18N2O7 and a molecular weight of 398.37 g/mol. Its IUPAC name is 3-[4-[2-(4-cyanophenyl)-2-oxoethoxy]phenyl]propanoic acid;oxamic acid.
| Compound Name | 3-[4-[2-(4-cyanophenyl)-2-oxoethoxy]phenyl]propanoic acid;oxamic acid |
|---|---|
| PubChem CID | 143975031 |
| Molecular Formula | C20H18N2O7 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-[4-[2-(4-cyanophenyl)-2-oxoethoxy]phenyl]propanoic acid;oxamic acid |
| SMILES | N#Cc1ccc(C(=O)COc2ccc(CCC(=O)O)cc2)cc1.NC(=O)C(=O)O |
| InChI | InChI=1S/C18H15NO4.C2H3NO3/c19-11-14-1-6-15(7-2-14)17(20)12-23-16-8-3-13(4-9-16)5-10-18(21)22;3-1(4)2(5)6/h1-4,6-9H,5,10,12H2,(H,21,22);(H2,3,4)(H,5,6) |
| InChIKey | YYASTQRKBJDLSH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 167.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|