About 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene
2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene (PubChem CID 143975792) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene.
Molecular Properties
| Compound Name | 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene |
| PubChem CID | 143975792 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene |
| SMILES | C=C.Cc1nc2c(o1)C=CC(C)C=C2 |
| InChI | InChI=1S/C10H11NO.C2H4/c1-7-3-5-9-10(6-4-7)12-8(2)11-9;1-2/h3-7H,1-2H3;1-2H2 |
| InChIKey | HOKQBTZGQNHYFG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene?
The IUPAC name of 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene (CID 143975792) is 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene.
What is the SMILES notation for 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene?
The canonical SMILES for 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene is C=C.Cc1nc2c(o1)C=CC(C)C=C2.
What is the InChIKey of 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene?
The InChIKey is HOKQBTZGQNHYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C2H4/c1-7-3-5-9-10(6-4-7)12-8(2)11-9;1-2/h3-7H,1-2H3;1-2H2.
What are the key properties of 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene?
2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene has a molecular weight of 189.26 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-6H-cyclohepta[d][1,3]oxazole;ethene is sourced from PubChem (CID 143975792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).