C31H25F2N5O3 — CID 143976012
(2E)-N-(4-fluorophenyl)-N'-[3-fluoro-4-[(2-phenyl-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]phenyl]-2-[1-(methylamino)ethylidene]propanediamide (PubChem CID 143976012) has the molecular formula C31H25F2N5O3 and a molecular weight of 553.57 g/mol. Its IUPAC name is (2E)-N-(4-fluorophenyl)-N'-[3-fluoro-4-[(2-phenyl-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]phenyl]-2-[1-(methylamino)ethylidene]propanediamide.
| Compound Name | (2E)-N-(4-fluorophenyl)-N'-[3-fluoro-4-[(2-phenyl-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]phenyl]-2-[1-(methylamino)ethylidene]propanediamide |
|---|---|
| PubChem CID | 143976012 |
| Molecular Formula | C31H25F2N5O3 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | (2E)-N-(4-fluorophenyl)-N'-[3-fluoro-4-[(2-phenyl-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]phenyl]-2-[1-(methylamino)ethylidene]propanediamide |
| SMILES | CN/C(C)=C(\C(=O)Nc1ccc(F)cc1)C(=O)Nc1ccc(Oc2ccnc3[nH]c(-c4ccccc4)cc23)c(F)c1 |
| InChI | InChI=1S/C31H25F2N5O3/c1-18(34-2)28(30(39)36-21-10-8-20(32)9-11-21)31(40)37-22-12-13-27(24(33)16-22)41-26-14-15-35-29-23(26)17-25(38-29)19-6-4-3-5-7-19/h3-17,34H,1-2H3,(H,35,38)(H,36,39)(H,37,40)/b28-18+ |
| InChIKey | YBWOLMXDABZWHR-MTDXEUNCSA-N |
| XLogP | 6.37 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|