C58H46N4 — CID 143976045
3-(4-carbazol-9-ylphenyl)-N,N-bis(4-methylphenyl)-5-[(3Z,5E)-5-(1-phenylbenzimidazol-2-yl)hepta-1,3,5-trien-2-yl]aniline (PubChem CID 143976045) has the molecular formula C58H46N4 and a molecular weight of 799.03 g/mol. Its IUPAC name is 3-(4-carbazol-9-ylphenyl)-N,N-bis(4-methylphenyl)-5-[(3Z,5E)-5-(1-phenylbenzimidazol-2-yl)hepta-1,3,5-trien-2-yl]aniline.
| Compound Name | 3-(4-carbazol-9-ylphenyl)-N,N-bis(4-methylphenyl)-5-[(3Z,5E)-5-(1-phenylbenzimidazol-2-yl)hepta-1,3,5-trien-2-yl]aniline |
|---|---|
| PubChem CID | 143976045 |
| Molecular Formula | C58H46N4 |
| Molecular Weight | 799.03 g/mol |
| Exact Mass | 798.37 |
| IUPAC Name | 3-(4-carbazol-9-ylphenyl)-N,N-bis(4-methylphenyl)-5-[(3Z,5E)-5-(1-phenylbenzimidazol-2-yl)hepta-1,3,5-trien-2-yl]aniline |
| SMILES | C=C(/C=C\C(=C/C)c1nc2ccccc2n1-c1ccccc1)c1cc(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)cc(N(c2ccc(C)cc2)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C58H46N4/c1-5-43(58-59-54-19-11-14-22-57(54)62(58)47-15-7-6-8-16-47)28-27-42(4)45-37-46(39-51(38-45)60(48-31-23-40(2)24-32-48)49-33-25-41(3)26-34-49)44-29-35-50(36-30-44)61-55-20-12-9-17-52(55)53-18-10-13-21-56(53)61/h5-39H,4H2,1-3H3/b28-27-,43-5+ |
| InChIKey | VHWHCDZOXAKYFS-GCWBGTLXSA-N |
| XLogP | 15.55 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.03 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|