About ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine
ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine (PubChem CID 143976601) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine |
| PubChem CID | 143976601 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine |
| SMILES | CC.CC.Cc1ccnc2cnoc12 |
| InChI | InChI=1S/C7H6N2O.2C2H6/c1-5-2-3-8-6-4-9-10-7(5)6;2*1-2/h2-4H,1H3;2*1-2H3 |
| InChIKey | PVJPOLNKPBLPKR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine?
The IUPAC name of ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine (CID 143976601) is ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine.
What is the SMILES notation for ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine?
The canonical SMILES for ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine is CC.CC.Cc1ccnc2cnoc12.
What is the InChIKey of ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine?
The InChIKey is PVJPOLNKPBLPKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O.2C2H6/c1-5-2-3-8-6-4-9-10-7(5)6;2*1-2/h2-4H,1H3;2*1-2H3.
What are the key properties of ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine?
ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine has a molecular weight of 194.28 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-[1,2]oxazolo[4,5-b]pyridine is sourced from PubChem (CID 143976601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).