C23H35NO5 — CID 143976822
tert-butyl 2-[[(3E,5E)-10-methoxy-4,5-dimethyl-7-methylidene-10-oxodeca-1,3,5-trien-2-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 143976822) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl 2-[[(3E,5E)-10-methoxy-4,5-dimethyl-7-methylidene-10-oxodeca-1,3,5-trien-2-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3E,5E)-10-methoxy-4,5-dimethyl-7-methylidene-10-oxodeca-1,3,5-trien-2-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 143976822 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | tert-butyl 2-[[(3E,5E)-10-methoxy-4,5-dimethyl-7-methylidene-10-oxodeca-1,3,5-trien-2-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | C=C(/C=C(C)/C(C)=C/C(=C)OCC1CCN1C(=O)OC(C)(C)C)CCC(=O)OC |
| InChI | InChI=1S/C23H35NO5/c1-16(9-10-21(25)27-8)13-17(2)18(3)14-19(4)28-15-20-11-12-24(20)22(26)29-23(5,6)7/h13-14,20H,1,4,9-12,15H2,2-3,5-8H3/b17-13+,18-14+ |
| InChIKey | CVAIFWGBHJSBDW-HBKJEHTGSA-N |
| XLogP | 4.93 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|