C19H29NO4 — CID 143976926
tert-butyl 2-[[(2E,4Z)-5-ethenyl-8-oxoocta-2,4-dien-3-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 143976926) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl 2-[[(2E,4Z)-5-ethenyl-8-oxoocta-2,4-dien-3-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(2E,4Z)-5-ethenyl-8-oxoocta-2,4-dien-3-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 143976926 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tert-butyl 2-[[(2E,4Z)-5-ethenyl-8-oxoocta-2,4-dien-3-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | C=C/C(=C\C(=C/C)OCC1CCN1C(=O)OC(C)(C)C)CCC=O |
| InChI | InChI=1S/C19H29NO4/c1-6-15(9-8-12-21)13-17(7-2)23-14-16-10-11-20(16)18(22)24-19(3,4)5/h6-7,12-13,16H,1,8-11,14H2,2-5H3/b15-13+,17-7+ |
| InChIKey | LVAVRTTZLXWQPB-GOIKBAAWSA-N |
| XLogP | 4.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|