C22H34ClNO3 — CID 143976974
tert-butyl 2-[[(3E,7E)-9-(chloromethyl)-4,7-dimethyldeca-1,3,7,9-tetraen-2-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 143976974) has the molecular formula C22H34ClNO3 and a molecular weight of 395.97 g/mol. Its IUPAC name is tert-butyl 2-[[(3E,7E)-9-(chloromethyl)-4,7-dimethyldeca-1,3,7,9-tetraen-2-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3E,7E)-9-(chloromethyl)-4,7-dimethyldeca-1,3,7,9-tetraen-2-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 143976974 |
| Molecular Formula | C22H34ClNO3 |
| Molecular Weight | 395.97 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | tert-butyl 2-[[(3E,7E)-9-(chloromethyl)-4,7-dimethyldeca-1,3,7,9-tetraen-2-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | C=C(/C=C(\C)CC/C(C)=C/C(=C)OCC1CCN1C(=O)OC(C)(C)C)CCl |
| InChI | InChI=1S/C22H34ClNO3/c1-16(12-18(3)14-23)8-9-17(2)13-19(4)26-15-20-10-11-24(20)21(25)27-22(5,6)7/h12-13,20H,3-4,8-11,14-15H2,1-2,5-7H3/b16-12+,17-13+ |
| InChIKey | XUXQTWWKWLPNSW-UNZYHPAISA-N |
| XLogP | 5.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.97 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|