C21H31NO5 — CID 143976979
tert-butyl 2-[[(2E,4Z,7E)-5-ethenyl-9-methoxy-9-oxonona-2,4,7-trien-3-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 143976979) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is tert-butyl 2-[[(2E,4Z,7E)-5-ethenyl-9-methoxy-9-oxonona-2,4,7-trien-3-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(2E,4Z,7E)-5-ethenyl-9-methoxy-9-oxonona-2,4,7-trien-3-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 143976979 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | tert-butyl 2-[[(2E,4Z,7E)-5-ethenyl-9-methoxy-9-oxonona-2,4,7-trien-3-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | C=C/C(=C\C(=C/C)OCC1CCN1C(=O)OC(C)(C)C)C/C=C/C(=O)OC |
| InChI | InChI=1S/C21H31NO5/c1-7-16(10-9-11-19(23)25-6)14-18(8-2)26-15-17-12-13-22(17)20(24)27-21(3,4)5/h7-9,11,14,17H,1,10,12-13,15H2,2-6H3/b11-9+,16-14+,18-8+ |
| InChIKey | VETVEZCBTFHZDY-SCLRJVAHSA-N |
| XLogP | 4.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|