C27H43NO6 — CID 143977010
tert-butyl 2-[[(2E,4E,6Z)-5-ethenyl-6-methoxy-8-(1-methoxybutoxymethyl)nona-2,4,6,8-tetraen-3-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 143977010) has the molecular formula C27H43NO6 and a molecular weight of 477.64 g/mol. Its IUPAC name is tert-butyl 2-[[(2E,4E,6Z)-5-ethenyl-6-methoxy-8-(1-methoxybutoxymethyl)nona-2,4,6,8-tetraen-3-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(2E,4E,6Z)-5-ethenyl-6-methoxy-8-(1-methoxybutoxymethyl)nona-2,4,6,8-tetraen-3-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 143977010 |
| Molecular Formula | C27H43NO6 |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | tert-butyl 2-[[(2E,4E,6Z)-5-ethenyl-6-methoxy-8-(1-methoxybutoxymethyl)nona-2,4,6,8-tetraen-3-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | C=CC(=C\C(=C/C)OCC1CCN1C(=O)OC(C)(C)C)/C(=C/C(=C)COC(CCC)OC)OC |
| InChI | InChI=1S/C27H43NO6/c1-10-13-25(31-9)33-18-20(4)16-24(30-8)21(11-2)17-23(12-3)32-19-22-14-15-28(22)26(29)34-27(5,6)7/h11-12,16-17,22,25H,2,4,10,13-15,18-19H2,1,3,5-9H3/b21-17+,23-12+,24-16- |
| InChIKey | XACXKSRUNZFDAO-UCIITCDMSA-N |
| XLogP | 5.90 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|