C22H36N2O3 — CID 143977016
tert-butyl 2-[[(3E,7E)-9-(aminomethyl)-4,7-dimethyldeca-1,3,7,9-tetraen-2-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 143977016) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is tert-butyl 2-[[(3E,7E)-9-(aminomethyl)-4,7-dimethyldeca-1,3,7,9-tetraen-2-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3E,7E)-9-(aminomethyl)-4,7-dimethyldeca-1,3,7,9-tetraen-2-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 143977016 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | tert-butyl 2-[[(3E,7E)-9-(aminomethyl)-4,7-dimethyldeca-1,3,7,9-tetraen-2-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | C=C(/C=C(\C)CC/C(C)=C/C(=C)OCC1CCN1C(=O)OC(C)(C)C)CN |
| InChI | InChI=1S/C22H36N2O3/c1-16(12-18(3)14-23)8-9-17(2)13-19(4)26-15-20-10-11-24(20)21(25)27-22(5,6)7/h12-13,20H,3-4,8-11,14-15,23H2,1-2,5-7H3/b16-12+,17-13+ |
| InChIKey | DLBGADIKFLNPRU-UNZYHPAISA-N |
| XLogP | 4.71 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|