About 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid
2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid (PubChem CID 143978054) has the molecular formula C20H22Cl2N4O3
and a molecular weight of 437.33 g/mol. Its IUPAC name is 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid |
| PubChem CID | 143978054 |
| Molecular Formula | C20H22Cl2N4O3 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid |
| SMILES | CN(c1ncccc1N(C=O)CC(=O)O)C1CCN(c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H22Cl2N4O3/c1-24(20-18(3-2-6-23-20)26(13-27)12-19(28)29)16-4-7-25(8-5-16)17-10-14(21)9-15(22)11-17/h2-3,6,9-11,13,16H,4-5,7-8,12H2,1H3,(H,28,29) |
| InChIKey | BGKMYODBBHXINU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid?
The IUPAC name of 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid (CID 143978054) is 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid.
What is the SMILES notation for 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid?
The canonical SMILES for 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid is CN(c1ncccc1N(C=O)CC(=O)O)C1CCN(c2cc(Cl)cc(Cl)c2)CC1.
What is the InChIKey of 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid?
The InChIKey is BGKMYODBBHXINU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N4O3/c1-24(20-18(3-2-6-23-20)26(13-27)12-19(28)29)16-4-7-25(8-5-16)17-10-14(21)9-15(22)11-17/h2-3,6,9-11,13,16H,4-5,7-8,12H2,1H3,(H,28,29).
What are the key properties of 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid?
2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid has a molecular weight of 437.33 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[[1-(3,5-dichlorophenyl)piperidin-4-yl]-methylamino]-3-pyridinyl]-formylamino]acetic acid is sourced from PubChem (CID 143978054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).