About (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene
(cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene (PubChem CID 143979079) has the molecular formula C14H16S3
and a molecular weight of 280.48 g/mol. Its IUPAC name is (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene.
Molecular Properties
| Compound Name | (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene |
| PubChem CID | 143979079 |
| Molecular Formula | C14H16S3 |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene |
| SMILES | C1=CC(CSSSCc2ccccc2)=CCC1 |
| InChI | InChI=1S/C14H16S3/c1-3-7-13(8-4-1)11-15-17-16-12-14-9-5-2-6-10-14/h1,3-5,7-10H,2,6,11-12H2 |
| InChIKey | IEUXJTWBZBJIOT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene?
The IUPAC name of (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene (CID 143979079) is (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene.
What is the SMILES notation for (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene?
The canonical SMILES for (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene is C1=CC(CSSSCc2ccccc2)=CCC1.
What is the InChIKey of (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene?
The InChIKey is IEUXJTWBZBJIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16S3/c1-3-7-13(8-4-1)11-15-17-16-12-14-9-5-2-6-10-14/h1,3-5,7-10H,2,6,11-12H2.
What are the key properties of (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene?
(cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene has a molecular weight of 280.48 g/mol, XLogP of 5.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene is sourced from PubChem (CID 143979079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).