C14H16S3 — CID 143979079
(cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene (PubChem CID 143979079) has the molecular formula C14H16S3 and a molecular weight of 280.48 g/mol. Its IUPAC name is (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene.
| Compound Name | (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene |
|---|---|
| PubChem CID | 143979079 |
| Molecular Formula | C14H16S3 |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | (cyclohexa-1,5-dien-1-ylmethyltrisulfanyl)methylbenzene |
| SMILES | C1=CC(CSSSCc2ccccc2)=CCC1 |
| InChI | InChI=1S/C14H16S3/c1-3-7-13(8-4-1)11-15-17-16-12-14-9-5-2-6-10-14/h1,3-5,7-10H,2,6,11-12H2 |
| InChIKey | IEUXJTWBZBJIOT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|