C14H20F3N3O — CID 143979325
2-[4-[(2Z,4Z)-3-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazin-1-yl]acetamide (PubChem CID 143979325) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-[4-[(2Z,4Z)-3-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazin-1-yl]acetamide.
| Compound Name | 2-[4-[(2Z,4Z)-3-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 143979325 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[4-[(2Z,4Z)-3-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazin-1-yl]acetamide |
| SMILES | C=C/C=C\C(=C(/C)N1CCN(CC(N)=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H20F3N3O/c1-3-4-5-12(14(15,16)17)11(2)20-8-6-19(7-9-20)10-13(18)21/h3-5H,1,6-10H2,2H3,(H2,18,21)/b5-4-,12-11- |
| InChIKey | NSIGAWDZLMMXEJ-NHTRZOJKSA-N |
| XLogP | 1.67 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|