About ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine]
ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine] (PubChem CID 143979461) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine].
Molecular Properties
| Compound Name | ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine] |
| PubChem CID | 143979461 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine] |
| SMILES | CC.CN1CCC2(CC1)CC1=CCC=CC=C1O2 |
| InChI | InChI=1S/C14H19NO.C2H6/c1-15-9-7-14(8-10-15)11-12-5-3-2-4-6-13(12)16-14;1-2/h2,4-6H,3,7-11H2,1H3;1-2H3 |
| InChIKey | GYABTTBUZNDXRH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine]?
The IUPAC name of ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine] (CID 143979461) is ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine].
What is the SMILES notation for ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine]?
The canonical SMILES for ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine] is CC.CN1CCC2(CC1)CC1=CCC=CC=C1O2.
What is the InChIKey of ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine]?
The InChIKey is GYABTTBUZNDXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO.C2H6/c1-15-9-7-14(8-10-15)11-12-5-3-2-4-6-13(12)16-14;1-2/h2,4-6H,3,7-11H2,1H3;1-2H3.
What are the key properties of ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine]?
ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine] has a molecular weight of 247.38 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1'-methylspiro[3,5-dihydrocyclohepta[b]furan-2,4'-piperidine] is sourced from PubChem (CID 143979461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).