About 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene
5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene (PubChem CID 143979469) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene.
Molecular Properties
| Compound Name | 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene |
| PubChem CID | 143979469 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene |
| SMILES | CC#Cc1c(C)cc(CC)cc1C |
| InChI | InChI=1S/C13H16/c1-5-7-13-10(3)8-12(6-2)9-11(13)4/h8-9H,6H2,1-4H3 |
| InChIKey | WQXNUFKXDUJVLF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene?
The IUPAC name of 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene (CID 143979469) is 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene.
What is the SMILES notation for 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene?
The canonical SMILES for 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene is CC#Cc1c(C)cc(CC)cc1C.
What is the InChIKey of 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene?
The InChIKey is WQXNUFKXDUJVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16/c1-5-7-13-10(3)8-12(6-2)9-11(13)4/h8-9H,6H2,1-4H3.
What are the key properties of 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene?
5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene has a molecular weight of 172.27 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3-dimethyl-2-prop-1-ynylbenzene is sourced from PubChem (CID 143979469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).