C13H27N3O3 — CID 143979675
(5R,8R)-3-(butylamino)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine-5,7,8-triol;ethane (PubChem CID 143979675) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is (5R,8R)-3-(butylamino)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine-5,7,8-triol;ethane.
| Compound Name | (5R,8R)-3-(butylamino)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine-5,7,8-triol;ethane |
|---|---|
| PubChem CID | 143979675 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (5R,8R)-3-(butylamino)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine-5,7,8-triol;ethane |
| SMILES | CC.CCCCNC1=NCC2[C@@H](O)C(O)C[C@@H](O)N12 |
| InChI | InChI=1S/C11H21N3O3.C2H6/c1-2-3-4-12-11-13-6-7-10(17)8(15)5-9(16)14(7)11;1-2/h7-10,15-17H,2-6H2,1H3,(H,12,13);1-2H3/t7?,8?,9-,10-;/m1./s1 |
| InChIKey | IMUHIBAIBKHKPI-FJEDJHNJSA-N |
| XLogP | -0.11 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|