C23H26O7 — CID 143979914
methyl (Z)-2-methylbut-2-enoate;[(9R)-8-methyl-2-oxo-8,9-dihydrofuro[2,3-h]chromen-9-yl] (Z)-2-methylbut-2-enoate (PubChem CID 143979914) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is methyl (Z)-2-methylbut-2-enoate;[(9R)-8-methyl-2-oxo-8,9-dihydrofuro[2,3-h]chromen-9-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | methyl (Z)-2-methylbut-2-enoate;[(9R)-8-methyl-2-oxo-8,9-dihydrofuro[2,3-h]chromen-9-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 143979914 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | methyl (Z)-2-methylbut-2-enoate;[(9R)-8-methyl-2-oxo-8,9-dihydrofuro[2,3-h]chromen-9-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC.C/C=C(/C)C(=O)O[C@@H]1c2c(ccc3ccc(=O)oc23)OC1C |
| InChI | InChI=1S/C17H16O5.C6H10O2/c1-4-9(2)17(19)22-15-10(3)20-12-7-5-11-6-8-13(18)21-16(11)14(12)15;1-4-5(2)6(7)8-3/h4-8,10,15H,1-3H3;4H,1-3H3/b9-4-;5-4-/t10?,15-;/m0./s1 |
| InChIKey | VVGVSOQLTQYGTK-JFBCPGSTSA-N |
| XLogP | 4.25 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|