C20H22F3N7O2 — CID 143980597
N-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]formamide;3-methyl-6-(2,2,2-trifluoroethoxy)pyrazin-2-amine (PubChem CID 143980597) has the molecular formula C20H22F3N7O2 and a molecular weight of 449.44 g/mol. Its IUPAC name is N-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]formamide;3-methyl-6-(2,2,2-trifluoroethoxy)pyrazin-2-amine.
| Compound Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]formamide;3-methyl-6-(2,2,2-trifluoroethoxy)pyrazin-2-amine |
|---|---|
| PubChem CID | 143980597 |
| Molecular Formula | C20H22F3N7O2 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]phenyl]formamide;3-methyl-6-(2,2,2-trifluoroethoxy)pyrazin-2-amine |
| SMILES | Cc1ncc(OCC(F)(F)F)nc1N.Nc1ncccc1NCc1cccc(NC=O)c1 |
| InChI | InChI=1S/C13H14N4O.C7H8F3N3O/c14-13-12(5-2-6-15-13)16-8-10-3-1-4-11(7-10)17-9-18;1-4-6(11)13-5(2-12-4)14-3-7(8,9)10/h1-7,9,16H,8H2,(H2,14,15)(H,17,18);2H,3H2,1H3,(H2,11,13) |
| InChIKey | ANROUXWOWHCBFQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|