C21H25N5O3 — CID 143980864
(3R,3aS)-6-[4-[[[(Z)-2-amino-3-hydrazinylprop-2-enyl]amino]methyl]phenyl]-3-(hydroxymethyl)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one (PubChem CID 143980864) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3R,3aS)-6-[4-[[[(Z)-2-amino-3-hydrazinylprop-2-enyl]amino]methyl]phenyl]-3-(hydroxymethyl)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one.
| Compound Name | (3R,3aS)-6-[4-[[[(Z)-2-amino-3-hydrazinylprop-2-enyl]amino]methyl]phenyl]-3-(hydroxymethyl)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
|---|---|
| PubChem CID | 143980864 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (3R,3aS)-6-[4-[[[(Z)-2-amino-3-hydrazinylprop-2-enyl]amino]methyl]phenyl]-3-(hydroxymethyl)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
| SMILES | NN/C=C(\N)CNCc1ccc(-c2ccc3c(c2)C[C@H]2[C@H](CO)OC(=O)N32)cc1 |
| InChI | InChI=1S/C21H25N5O3/c22-17(11-25-23)10-24-9-13-1-3-14(4-2-13)15-5-6-18-16(7-15)8-19-20(12-27)29-21(28)26(18)19/h1-7,11,19-20,24-25,27H,8-10,12,22-23H2/b17-11-/t19-,20-/m0/s1 |
| InChIKey | RXFIDQVSVRXPKQ-UGRGDJTCSA-N |
| XLogP | 0.95 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|