C23H27ClN4O4 — CID 143980998
4-chloroaniline;1-[4-(2-cyclopropyl-3-hydroxypropoxy)-3-methoxyphenyl]-3,4-diiminopyrrolidin-2-one (PubChem CID 143980998) has the molecular formula C23H27ClN4O4 and a molecular weight of 458.95 g/mol. Its IUPAC name is 4-chloroaniline;1-[4-(2-cyclopropyl-3-hydroxypropoxy)-3-methoxyphenyl]-3,4-diiminopyrrolidin-2-one.
| Compound Name | 4-chloroaniline;1-[4-(2-cyclopropyl-3-hydroxypropoxy)-3-methoxyphenyl]-3,4-diiminopyrrolidin-2-one |
|---|---|
| PubChem CID | 143980998 |
| Molecular Formula | C23H27ClN4O4 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 4-chloroaniline;1-[4-(2-cyclopropyl-3-hydroxypropoxy)-3-methoxyphenyl]-3,4-diiminopyrrolidin-2-one |
| SMILES | Nc1ccc(Cl)cc1.[H]/N=C1\CN(c2ccc(OCC(CO)C3CC3)c(OC)c2)C(=O)\C1=N\[H] |
| InChI | InChI=1S/C17H21N3O4.C6H6ClN/c1-23-15-6-12(20-7-13(18)16(19)17(20)22)4-5-14(15)24-9-11(8-21)10-2-3-10;7-5-1-3-6(8)4-2-5/h4-6,10-11,18-19,21H,2-3,7-9H2,1H3;1-4H,8H2/b18-13+,19-16+; |
| InChIKey | COXGWJXSOHKJTO-FLFKJSJDSA-N |
| XLogP | 3.40 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|