C8H11BrFN — CID 143981077
(1Z,3E)-4-bromo-2-fluoro-N,N-dimethylhexa-1,3,5-trien-1-amine (PubChem CID 143981077) has the molecular formula C8H11BrFN and a molecular weight of 220.08 g/mol. Its IUPAC name is (1Z,3E)-4-bromo-2-fluoro-N,N-dimethylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-4-bromo-2-fluoro-N,N-dimethylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143981077 |
| Molecular Formula | C8H11BrFN |
| Molecular Weight | 220.08 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | (1Z,3E)-4-bromo-2-fluoro-N,N-dimethylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(Br)=C\C(F)=C\N(C)C |
| InChI | InChI=1S/C8H11BrFN/c1-4-7(9)5-8(10)6-11(2)3/h4-6H,1H2,2-3H3/b7-5+,8-6- |
| InChIKey | GHTAXHNIQSCAOQ-YMBWGVAGSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.08 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|