N-ethenylprop-2-enimidoyl fluoride

C5H6FN — CID 143981222

IUPACN-ethenylprop-2-enimidoyl fluoride
SMILESC=C/N=C(\F)C=C
InChIInChI=1S/C5H6FN/c1-3-5(6)7-4-2/h3-4H,1-2H2/b7-5-
InChIKeyJAZWKFYHPMAZMN-ALCCZGGFSA-N
MW99.11 g/mol
LogP1.68
Rot. Bonds2

About N-ethenylprop-2-enimidoyl fluoride

N-ethenylprop-2-enimidoyl fluoride (PubChem CID 143981222) has the molecular formula C5H6FN and a molecular weight of 99.11 g/mol. Its IUPAC name is N-ethenylprop-2-enimidoyl fluoride.

Molecular Properties

Compound NameN-ethenylprop-2-enimidoyl fluoride
PubChem CID143981222
Molecular FormulaC5H6FN
Molecular Weight99.11 g/mol
Exact Mass99.05
IUPAC NameN-ethenylprop-2-enimidoyl fluoride
SMILESC=C/N=C(\F)C=C
InChIInChI=1S/C5H6FN/c1-3-5(6)7-4-2/h3-4H,1-2H2/b7-5-
InChIKeyJAZWKFYHPMAZMN-ALCCZGGFSA-N
XLogP1.68
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50099.11
LogP ≤ 51.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-ethenylprop-2-enimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-ethenylprop-2-enimidoyl fluoride?
The IUPAC name of N-ethenylprop-2-enimidoyl fluoride (CID 143981222) is N-ethenylprop-2-enimidoyl fluoride.
What is the SMILES notation for N-ethenylprop-2-enimidoyl fluoride?
The canonical SMILES for N-ethenylprop-2-enimidoyl fluoride is C=C/N=C(\F)C=C.
What is the InChIKey of N-ethenylprop-2-enimidoyl fluoride?
The InChIKey is JAZWKFYHPMAZMN-ALCCZGGFSA-N. The full InChI is InChI=1S/C5H6FN/c1-3-5(6)7-4-2/h3-4H,1-2H2/b7-5-.
What are the key properties of N-ethenylprop-2-enimidoyl fluoride?
N-ethenylprop-2-enimidoyl fluoride has a molecular weight of 99.11 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylprop-2-enimidoyl fluoride is sourced from PubChem (CID 143981222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).