C23H26FN7O2 — CID 143981458
N'-[3-fluoro-4-[4-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]oxyphenyl]phenyl]-N-hydrazinylidenemethanimidamide (PubChem CID 143981458) has the molecular formula C23H26FN7O2 and a molecular weight of 451.51 g/mol. Its IUPAC name is N'-[3-fluoro-4-[4-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]oxyphenyl]phenyl]-N-hydrazinylidenemethanimidamide.
| Compound Name | N'-[3-fluoro-4-[4-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]oxyphenyl]phenyl]-N-hydrazinylidenemethanimidamide |
|---|---|
| PubChem CID | 143981458 |
| Molecular Formula | C23H26FN7O2 |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N'-[3-fluoro-4-[4-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]oxyphenyl]phenyl]-N-hydrazinylidenemethanimidamide |
| SMILES | CC(C)c1noc(N2CCC(Oc3ccc(-c4ccc(/N=C/N=N/N)cc4F)cc3)CC2)n1 |
| InChI | InChI=1S/C23H26FN7O2/c1-15(2)22-28-23(33-29-22)31-11-9-19(10-12-31)32-18-6-3-16(4-7-18)20-8-5-17(13-21(20)24)26-14-27-30-25/h3-8,13-15,19H,9-12H2,1-2H3,(H2,25,26,27) |
| InChIKey | FOBXIVFKUBMRDS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|