C38H34FP — CID 143982080
(19-fluoro-11,11,16,16,22,22,30,30-octamethyl-8-nonacyclo[15.11.1.16,26.02,15.03,12.04,27.05,10.021,29.023,28]triaconta-1,3,5,7,9,12,14,17,19,21(29),23(28),24,26-tridecaenyl)phosphane (PubChem CID 143982080) has the molecular formula C38H34FP and a molecular weight of 540.66 g/mol. Its IUPAC name is (19-fluoro-11,11,16,16,22,22,30,30-octamethyl-8-nonacyclo[15.11.1.16,26.02,15.03,12.04,27.05,10.021,29.023,28]triaconta-1,3,5,7,9,12,14,17,19,21(29),23(28),24,26-tridecaenyl)phosphane.
| Compound Name | (19-fluoro-11,11,16,16,22,22,30,30-octamethyl-8-nonacyclo[15.11.1.16,26.02,15.03,12.04,27.05,10.021,29.023,28]triaconta-1,3,5,7,9,12,14,17,19,21(29),23(28),24,26-tridecaenyl)phosphane |
|---|---|
| PubChem CID | 143982080 |
| Molecular Formula | C38H34FP |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | (19-fluoro-11,11,16,16,22,22,30,30-octamethyl-8-nonacyclo[15.11.1.16,26.02,15.03,12.04,27.05,10.021,29.023,28]triaconta-1,3,5,7,9,12,14,17,19,21(29),23(28),24,26-tridecaenyl)phosphane |
| SMILES | CC1(C)c2cc(F)cc3c2-c2c4c1ccc1c4c4c5c(ccc(c25)C3(C)C)C(C)(C)c2cc(P)cc(c2-4)C1(C)C |
| InChI | InChI=1S/C38H34FP/c1-35(2)19-9-11-21-31-29(19)33-27-23(35)13-17(39)14-24(27)36(3,4)20-10-12-22-32(30(20)33)34(31)28-25(37(21,5)6)15-18(40)16-26(28)38(22,7)8/h9-16H,40H2,1-8H3 |
| InChIKey | YNIWJQSLVBENBS-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|