C6H13NO2 — CID 143982374
(1S)-1-pyrrolidin-1-ylethane-1,2-diol (PubChem CID 143982374) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is (1S)-1-pyrrolidin-1-ylethane-1,2-diol.
| Compound Name | (1S)-1-pyrrolidin-1-ylethane-1,2-diol |
|---|---|
| PubChem CID | 143982374 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (1S)-1-pyrrolidin-1-ylethane-1,2-diol |
| SMILES | OC[C@H](O)N1CCCC1 |
| InChI | InChI=1S/C6H13NO2/c8-5-6(9)7-3-1-2-4-7/h6,8-9H,1-5H2/t6-/m0/s1 |
| InChIKey | MGRMEQYGZPAYFQ-LURJTMIESA-N |
| XLogP | -0.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |