About [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate
[3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate (PubChem CID 143982377) has the molecular formula C14H21NO8
and a molecular weight of 331.32 g/mol. Its IUPAC name is [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate.
Molecular Properties
| Compound Name | [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate |
| PubChem CID | 143982377 |
| Molecular Formula | C14H21NO8 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1(OC(C)=O)CNCC1(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C14H21NO8/c1-9(16)20-7-13(22-11(3)18)5-15-6-14(13,23-12(4)19)8-21-10(2)17/h15H,5-8H2,1-4H3 |
| InChIKey | UYMFCHJGHHJOFJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate?
The IUPAC name of [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate (CID 143982377) is [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate.
What is the SMILES notation for [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate?
The canonical SMILES for [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate is CC(=O)OCC1(OC(C)=O)CNCC1(COC(C)=O)OC(C)=O.
What is the InChIKey of [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate?
The InChIKey is UYMFCHJGHHJOFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO8/c1-9(16)20-7-13(22-11(3)18)5-15-6-14(13,23-12(4)19)8-21-10(2)17/h15H,5-8H2,1-4H3.
What are the key properties of [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate?
[3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate has a molecular weight of 331.32 g/mol, XLogP of -0.68, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4-diacetyloxy-4-(acetyloxymethyl)pyrrolidin-3-yl]methyl acetate is sourced from PubChem (CID 143982377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).