About chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide
chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide (PubChem CID 143982422) has the molecular formula C16H16ClNO2
and a molecular weight of 289.76 g/mol. Its IUPAC name is chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide.
Molecular Properties
| Compound Name | chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide |
| PubChem CID | 143982422 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(N)=O)cc1O.Clc1ccccc1 |
| InChI | InChI=1S/C10H11NO2.C6H5Cl/c1-7-2-3-8(6-9(7)12)4-5-10(11)13;7-6-4-2-1-3-5-6/h2-6,12H,1H3,(H2,11,13);1-5H/b5-4+; |
| InChIKey | SEHDZYPACDAEEL-FXRZFVDSSA-N |
| XLogP | 3.54 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide?
The IUPAC name of chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide (CID 143982422) is chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide.
What is the SMILES notation for chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide?
The canonical SMILES for chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide is Cc1ccc(/C=C/C(N)=O)cc1O.Clc1ccccc1.
What is the InChIKey of chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide?
The InChIKey is SEHDZYPACDAEEL-FXRZFVDSSA-N. The full InChI is InChI=1S/C10H11NO2.C6H5Cl/c1-7-2-3-8(6-9(7)12)4-5-10(11)13;7-6-4-2-1-3-5-6/h2-6,12H,1H3,(H2,11,13);1-5H/b5-4+;.
What are the key properties of chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide?
chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide has a molecular weight of 289.76 g/mol, XLogP of 3.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;(E)-3-(3-hydroxy-4-methylphenyl)prop-2-enamide is sourced from PubChem (CID 143982422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).