C24H32N2O — CID 143982822
[4-(2-cyclopropyl-4-methylphenyl)piperazin-1-yl]-(4-methylphenyl)methanone;ethane (PubChem CID 143982822) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is [4-(2-cyclopropyl-4-methylphenyl)piperazin-1-yl]-(4-methylphenyl)methanone;ethane.
| Compound Name | [4-(2-cyclopropyl-4-methylphenyl)piperazin-1-yl]-(4-methylphenyl)methanone;ethane |
|---|---|
| PubChem CID | 143982822 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | [4-(2-cyclopropyl-4-methylphenyl)piperazin-1-yl]-(4-methylphenyl)methanone;ethane |
| SMILES | CC.Cc1ccc(C(=O)N2CCN(c3ccc(C)cc3C3CC3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O.C2H6/c1-16-3-6-19(7-4-16)22(25)24-13-11-23(12-14-24)21-10-5-17(2)15-20(21)18-8-9-18;1-2/h3-7,10,15,18H,8-9,11-14H2,1-2H3;1-2H3 |
| InChIKey | LQXVEMOWOLLPKW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |