C7H7F3N2 — CID 143982964
(2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1,6-diimine (PubChem CID 143982964) has the molecular formula C7H7F3N2 and a molecular weight of 176.14 g/mol. Its IUPAC name is (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1,6-diimine.
| Compound Name | (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1,6-diimine |
|---|---|
| PubChem CID | 143982964 |
| Molecular Formula | C7H7F3N2 |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1,6-diimine |
| SMILES | [H]/N=C\C=C/C(=C\C=N/[H])C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2/c8-7(9,10)6(3-5-12)2-1-4-11/h1-5,11-12H/b2-1-,6-3+,11-4-,12-5- |
| InChIKey | NCALKUJJHGTJES-ZWIMPEOISA-N |
| XLogP | 2.33 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|