C30H35N — CID 143983259
ethane;2-ethenyl-3,4,4-trimethyl-12-phenyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaene (PubChem CID 143983259) has the molecular formula C30H35N and a molecular weight of 409.62 g/mol. Its IUPAC name is ethane;2-ethenyl-3,4,4-trimethyl-12-phenyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaene.
| Compound Name | ethane;2-ethenyl-3,4,4-trimethyl-12-phenyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaene |
|---|---|
| PubChem CID | 143983259 |
| Molecular Formula | C30H35N |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | ethane;2-ethenyl-3,4,4-trimethyl-12-phenyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaene |
| SMILES | C=CC1=C(C)C(C)(C)c2cccc3c4cc(-c5ccccc5)ccc4n1c23.CC.CC |
| InChI | InChI=1S/C26H23N.2C2H6/c1-5-23-17(2)26(3,4)22-13-9-12-20-21-16-19(18-10-7-6-8-11-18)14-15-24(21)27(23)25(20)22;2*1-2/h5-16H,1H2,2-4H3;2*1-2H3 |
| InChIKey | XYUXWKKVQVTRMS-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |