C40H36N2O — CID 143983313
N-(4-methoxyphenyl)-13,13-dimethyl-N-[(2E,4Z)-6-phenylhexa-2,4-dien-3-yl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaen-5-amine (PubChem CID 143983313) has the molecular formula C40H36N2O and a molecular weight of 560.74 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-13,13-dimethyl-N-[(2E,4Z)-6-phenylhexa-2,4-dien-3-yl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaen-5-amine.
| Compound Name | N-(4-methoxyphenyl)-13,13-dimethyl-N-[(2E,4Z)-6-phenylhexa-2,4-dien-3-yl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaen-5-amine |
|---|---|
| PubChem CID | 143983313 |
| Molecular Formula | C40H36N2O |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | N-(4-methoxyphenyl)-13,13-dimethyl-N-[(2E,4Z)-6-phenylhexa-2,4-dien-3-yl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaen-5-amine |
| SMILES | C/C=C(\C=C/Cc1ccccc1)N(c1ccc(OC)cc1)c1ccc2c(c1)c1cccc3c1n2-c1ccccc1C3(C)C |
| InChI | InChI=1S/C40H36N2O/c1-5-29(16-11-15-28-13-7-6-8-14-28)41(30-21-24-32(43-4)25-22-30)31-23-26-37-34(27-31)33-17-12-19-36-39(33)42(37)38-20-10-9-18-35(38)40(36,2)3/h5-14,16-27H,15H2,1-4H3/b16-11-,29-5+ |
| InChIKey | DVHAMWJQYJPAME-XSHXFNNCSA-N |
| XLogP | 10.27 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|