C50H50N2 — CID 143983630
N-(3,5-dimethylphenyl)-N-[4-[4-ethyl-3-[(Z)-2-methylhex-4-en-2-yl]phenyl]phenyl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaen-5-amine (PubChem CID 143983630) has the molecular formula C50H50N2 and a molecular weight of 678.96 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-[4-[4-ethyl-3-[(Z)-2-methylhex-4-en-2-yl]phenyl]phenyl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaen-5-amine.
| Compound Name | N-(3,5-dimethylphenyl)-N-[4-[4-ethyl-3-[(Z)-2-methylhex-4-en-2-yl]phenyl]phenyl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaen-5-amine |
|---|---|
| PubChem CID | 143983630 |
| Molecular Formula | C50H50N2 |
| Molecular Weight | 678.96 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-[4-[4-ethyl-3-[(Z)-2-methylhex-4-en-2-yl]phenyl]phenyl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaen-5-amine |
| SMILES | C/C=C\CC(C)(C)c1cc(-c2ccc(N(c3cc(C)cc(C)c3)c3ccc4c(c3)c3cccc5c3n4-c3ccccc3C5(C)C)cc2)ccc1CC |
| InChI | InChI=1S/C50H50N2/c1-9-11-27-49(5,6)45-31-37(20-19-35(45)10-2)36-21-23-38(24-22-36)51(40-29-33(3)28-34(4)30-40)39-25-26-46-42(32-39)41-15-14-17-44-48(41)52(46)47-18-13-12-16-43(47)50(44,7)8/h9,11-26,28-32H,10,27H2,1-8H3/b11-9- |
| InChIKey | AYAHEEXAGYPYEV-LUAWRHEFSA-N |
| XLogP | 13.98 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.96 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|