C52H46N2S2 — CID 143984060
10'-[4-[(E)-2-[1,3,3-trimethyl-2-[(1E)-2-phenothiazin-10-ylbuta-1,3-dienyl]inden-5-yl]ethenyl]phenyl]spiro[2,3,4,5-tetrahydrothiophene-1,5'-phenothiazine] (PubChem CID 143984060) has the molecular formula C52H46N2S2 and a molecular weight of 763.09 g/mol. Its IUPAC name is 10'-[4-[(E)-2-[1,3,3-trimethyl-2-[(1E)-2-phenothiazin-10-ylbuta-1,3-dienyl]inden-5-yl]ethenyl]phenyl]spiro[2,3,4,5-tetrahydrothiophene-1,5'-phenothiazine].
| Compound Name | 10'-[4-[(E)-2-[1,3,3-trimethyl-2-[(1E)-2-phenothiazin-10-ylbuta-1,3-dienyl]inden-5-yl]ethenyl]phenyl]spiro[2,3,4,5-tetrahydrothiophene-1,5'-phenothiazine] |
|---|---|
| PubChem CID | 143984060 |
| Molecular Formula | C52H46N2S2 |
| Molecular Weight | 763.09 g/mol |
| Exact Mass | 762.31 |
| IUPAC Name | 10'-[4-[(E)-2-[1,3,3-trimethyl-2-[(1E)-2-phenothiazin-10-ylbuta-1,3-dienyl]inden-5-yl]ethenyl]phenyl]spiro[2,3,4,5-tetrahydrothiophene-1,5'-phenothiazine] |
| SMILES | C=C/C(=C\C1=C(C)c2ccc(/C=C/c3ccc(N4c5ccccc5S5(CCCC5)c5ccccc54)cc3)cc2C1(C)C)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C52H46N2S2/c1-5-39(53-44-16-6-10-20-48(44)55-49-21-11-7-17-45(49)53)35-42-36(2)41-31-28-38(34-43(41)52(42,3)4)25-24-37-26-29-40(30-27-37)54-46-18-8-12-22-50(46)56(32-14-15-33-56)51-23-13-9-19-47(51)54/h5-13,16-31,34-35H,1,14-15,32-33H2,2-4H3/b25-24+,39-35+ |
| InChIKey | VVSXHMIQAXOLHX-JJNCKKCLSA-N |
| XLogP | 15.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.09 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|