About 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene
2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene (PubChem CID 143984358) has the molecular formula C12H14
and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene |
| PubChem CID | 143984358 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene |
| SMILES | C=CC(=C)/C=C\C1=CCCC=C1 |
| InChI | InChI=1S/C12H14/c1-3-11(2)9-10-12-7-5-4-6-8-12/h3,5,7-10H,1-2,4,6H2/b10-9- |
| InChIKey | RCQCNAWNUVAFDO-KTKRTIGZSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene?
The IUPAC name of 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene (CID 143984358) is 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene.
What is the SMILES notation for 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene?
The canonical SMILES for 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene is C=CC(=C)/C=C\C1=CCCC=C1.
What is the InChIKey of 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene?
The InChIKey is RCQCNAWNUVAFDO-KTKRTIGZSA-N. The full InChI is InChI=1S/C12H14/c1-3-11(2)9-10-12-7-5-4-6-8-12/h3,5,7-10H,1-2,4,6H2/b10-9-.
What are the key properties of 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene?
2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene has a molecular weight of 158.24 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclohexa-1,3-diene is sourced from PubChem (CID 143984358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).