C23H31FN6O2 — CID 143984809
(E)-2-[(Z)-2-(dimethylamino)-2-(2-fluoro-4-methylphenyl)ethenyl]-4-morpholin-4-yl-N-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]but-2-enamide (PubChem CID 143984809) has the molecular formula C23H31FN6O2 and a molecular weight of 442.54 g/mol. Its IUPAC name is (E)-2-[(Z)-2-(dimethylamino)-2-(2-fluoro-4-methylphenyl)ethenyl]-4-morpholin-4-yl-N-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]but-2-enamide.
| Compound Name | (E)-2-[(Z)-2-(dimethylamino)-2-(2-fluoro-4-methylphenyl)ethenyl]-4-morpholin-4-yl-N-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 143984809 |
| Molecular Formula | C23H31FN6O2 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (E)-2-[(Z)-2-(dimethylamino)-2-(2-fluoro-4-methylphenyl)ethenyl]-4-morpholin-4-yl-N-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]but-2-enamide |
| SMILES | Cc1ccc(/C(=C/C(=C\CN2CCOCC2)C(=O)N[C@@H](C)c2ncn[nH]2)N(C)C)c(F)c1 |
| InChI | InChI=1S/C23H31FN6O2/c1-16-5-6-19(20(24)13-16)21(29(3)4)14-18(7-8-30-9-11-32-12-10-30)23(31)27-17(2)22-25-15-26-28-22/h5-7,13-15,17H,8-12H2,1-4H3,(H,27,31)(H,25,26,28)/b18-7+,21-14-/t17-/m0/s1 |
| InChIKey | HNYIDRUKJDDEJJ-FGMQTPHNSA-N |
| XLogP | 2.29 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|