About (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine
(2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine (PubChem CID 143984814) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine.
Molecular Properties
| Compound Name | (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine |
| PubChem CID | 143984814 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine |
| SMILES | CN1CCO[C@H](C2=CCC=CC=C2)C1 |
| InChI | InChI=1S/C12H17NO/c1-13-8-9-14-12(10-13)11-6-4-2-3-5-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-/m0/s1 |
| InChIKey | PLFLVBRLOJVPRG-LBPRGKRZSA-N |
| XLogP | 1.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine?
The IUPAC name of (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine (CID 143984814) is (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine.
What is the SMILES notation for (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine?
The canonical SMILES for (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine is CN1CCO[C@H](C2=CCC=CC=C2)C1.
What is the InChIKey of (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine?
The InChIKey is PLFLVBRLOJVPRG-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H17NO/c1-13-8-9-14-12(10-13)11-6-4-2-3-5-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-/m0/s1.
What are the key properties of (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine?
(2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine has a molecular weight of 191.27 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyclohepta-1,4,6-trien-1-yl-4-methylmorpholine is sourced from PubChem (CID 143984814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).