C8H14N2O — CID 143984841
5-[(2S)-butan-2-yl]-3-ethyl-1,2,4-oxadiazole (PubChem CID 143984841) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 5-[(2S)-butan-2-yl]-3-ethyl-1,2,4-oxadiazole.
| Compound Name | 5-[(2S)-butan-2-yl]-3-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 143984841 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 5-[(2S)-butan-2-yl]-3-ethyl-1,2,4-oxadiazole |
| SMILES | CCc1noc([C@@H](C)CC)n1 |
| InChI | InChI=1S/C8H14N2O/c1-4-6(3)8-9-7(5-2)10-11-8/h6H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | HXJVAOCORUGALI-LURJTMIESA-N |
| XLogP | 2.15 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |