C21H26Br2N2O3S2 — CID 143985092
4,8-bis[(4-bromophenyl)sulfinyl]-1-oxa-4,8-diazaspiro[4.5]decane;ethane (PubChem CID 143985092) has the molecular formula C21H26Br2N2O3S2 and a molecular weight of 578.39 g/mol. Its IUPAC name is 4,8-bis[(4-bromophenyl)sulfinyl]-1-oxa-4,8-diazaspiro[4.5]decane;ethane.
| Compound Name | 4,8-bis[(4-bromophenyl)sulfinyl]-1-oxa-4,8-diazaspiro[4.5]decane;ethane |
|---|---|
| PubChem CID | 143985092 |
| Molecular Formula | C21H26Br2N2O3S2 |
| Molecular Weight | 578.39 g/mol |
| Exact Mass | 575.98 |
| IUPAC Name | 4,8-bis[(4-bromophenyl)sulfinyl]-1-oxa-4,8-diazaspiro[4.5]decane;ethane |
| SMILES | CC.O=S(c1ccc(Br)cc1)N1CCC2(CC1)OCCN2S(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H20Br2N2O3S2.C2H6/c20-15-1-5-17(6-2-15)27(24)22-11-9-19(10-12-22)23(13-14-26-19)28(25)18-7-3-16(21)4-8-18;1-2/h1-8H,9-14H2;1-2H3 |
| InChIKey | HEDISDVFOBCCPM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |