About ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one
ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one (PubChem CID 143985110) has the molecular formula C18H21NO3S
and a molecular weight of 331.44 g/mol. Its IUPAC name is ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one.
Molecular Properties
| Compound Name | ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one |
| PubChem CID | 143985110 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one |
| SMILES | CC.COc1ccc(S(=O)N2CCC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C16H15NO3S.C2H6/c1-20-12-6-8-13(9-7-12)21(19)17-11-10-16(18)14-4-2-3-5-15(14)17;1-2/h2-9H,10-11H2,1H3;1-2H3 |
| InChIKey | VNPLAFFQCYLPOR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one?
The IUPAC name of ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one (CID 143985110) is ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one.
What is the SMILES notation for ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one?
The canonical SMILES for ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one is CC.COc1ccc(S(=O)N2CCC(=O)c3ccccc32)cc1.
What is the InChIKey of ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one?
The InChIKey is VNPLAFFQCYLPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO3S.C2H6/c1-20-12-6-8-13(9-7-12)21(19)17-11-10-16(18)14-4-2-3-5-15(14)17;1-2/h2-9H,10-11H2,1H3;1-2H3.
What are the key properties of ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one?
ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one has a molecular weight of 331.44 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(4-methoxyphenyl)sulfinyl-2,3-dihydroquinolin-4-one is sourced from PubChem (CID 143985110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).