About 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane
4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane (PubChem CID 143985171) has the molecular formula C13H28N2OS
and a molecular weight of 260.45 g/mol. Its IUPAC name is 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane.
Molecular Properties
| Compound Name | 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane |
| PubChem CID | 143985171 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane |
| SMILES | CC.CC.CN1CCC2(CC1)SCC(=O)N2C |
| InChI | InChI=1S/C9H16N2OS.2C2H6/c1-10-5-3-9(4-6-10)11(2)8(12)7-13-9;2*1-2/h3-7H2,1-2H3;2*1-2H3 |
| InChIKey | VSECMLNUQVNMIY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane?
The IUPAC name of 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane (CID 143985171) is 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane.
What is the SMILES notation for 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane?
The canonical SMILES for 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane is CC.CC.CN1CCC2(CC1)SCC(=O)N2C.
What is the InChIKey of 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane?
The InChIKey is VSECMLNUQVNMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS.2C2H6/c1-10-5-3-9(4-6-10)11(2)8(12)7-13-9;2*1-2/h3-7H2,1-2H3;2*1-2H3.
What are the key properties of 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane?
4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane has a molecular weight of 260.45 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;ethane is sourced from PubChem (CID 143985171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).