About 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane
2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane (PubChem CID 143985479) has the molecular formula C12H17FO
and a molecular weight of 196.26 g/mol. Its IUPAC name is 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane.
Molecular Properties
| Compound Name | 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane |
| PubChem CID | 143985479 |
| Molecular Formula | C12H17FO |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane |
| SMILES | C=C(F)/C=C\C(=C)C1(C)OC1CCC |
| InChI | InChI=1S/C12H17FO/c1-5-6-11-12(4,14-11)9(2)7-8-10(3)13/h7-8,11H,2-3,5-6H2,1,4H3/b8-7- |
| InChIKey | KHQSSRJEOHWGMI-FPLPWBNLSA-N |
| XLogP | 3.54 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane?
The IUPAC name of 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane (CID 143985479) is 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane.
What is the SMILES notation for 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane?
The canonical SMILES for 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane is C=C(F)/C=C\C(=C)C1(C)OC1CCC.
What is the InChIKey of 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane?
The InChIKey is KHQSSRJEOHWGMI-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H17FO/c1-5-6-11-12(4,14-11)9(2)7-8-10(3)13/h7-8,11H,2-3,5-6H2,1,4H3/b8-7-.
What are the key properties of 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane?
2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane has a molecular weight of 196.26 g/mol, XLogP of 3.54, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methyl-3-propyloxirane is sourced from PubChem (CID 143985479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).