About 4-methylcyclohexa-2,4-dien-1-imine
4-methylcyclohexa-2,4-dien-1-imine (PubChem CID 14398593) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is 4-methylcyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 4-methylcyclohexa-2,4-dien-1-imine |
| PubChem CID | 14398593 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 4-methylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(C)=CC1 |
| InChI | InChI=1S/C7H9N/c1-6-2-4-7(8)5-3-6/h2-4,8H,5H2,1H3/b8-7+ |
| InChIKey | HIAOIISHTGSGPP-BQYQJAHWSA-N |
| XLogP | 1.91 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylcyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclohexa-2,4-dien-1-imine?
The IUPAC name of 4-methylcyclohexa-2,4-dien-1-imine (CID 14398593) is 4-methylcyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 4-methylcyclohexa-2,4-dien-1-imine?
The canonical SMILES for 4-methylcyclohexa-2,4-dien-1-imine is [H]/N=C1\C=CC(C)=CC1.
What is the InChIKey of 4-methylcyclohexa-2,4-dien-1-imine?
The InChIKey is HIAOIISHTGSGPP-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H9N/c1-6-2-4-7(8)5-3-6/h2-4,8H,5H2,1H3/b8-7+.
What are the key properties of 4-methylcyclohexa-2,4-dien-1-imine?
4-methylcyclohexa-2,4-dien-1-imine has a molecular weight of 107.16 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 14398593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).