C15H16Cl2 — CID 143986114
1-(chloromethyl)-4-[(2E,4Z)-6-(chloromethyl)hepta-2,4,6-trien-3-yl]benzene (PubChem CID 143986114) has the molecular formula C15H16Cl2 and a molecular weight of 267.20 g/mol. Its IUPAC name is 1-(chloromethyl)-4-[(2E,4Z)-6-(chloromethyl)hepta-2,4,6-trien-3-yl]benzene.
| Compound Name | 1-(chloromethyl)-4-[(2E,4Z)-6-(chloromethyl)hepta-2,4,6-trien-3-yl]benzene |
|---|---|
| PubChem CID | 143986114 |
| Molecular Formula | C15H16Cl2 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1-(chloromethyl)-4-[(2E,4Z)-6-(chloromethyl)hepta-2,4,6-trien-3-yl]benzene |
| SMILES | C=C(/C=C\C(=C/C)c1ccc(CCl)cc1)CCl |
| InChI | InChI=1S/C15H16Cl2/c1-3-14(7-4-12(2)10-16)15-8-5-13(11-17)6-9-15/h3-9H,2,10-11H2,1H3/b7-4-,14-3+ |
| InChIKey | OLFSMHVANMUVMQ-NQWNGWNOSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|