C59H54N2 — CID 143986348
2-N-(4-methylphenyl)-2-N,6-N-bis(3-methyl-5-propan-2-ylphenyl)-6-N,9,10-triphenylanthracene-2,6-diamine (PubChem CID 143986348) has the molecular formula C59H54N2 and a molecular weight of 791.10 g/mol. Its IUPAC name is 2-N-(4-methylphenyl)-2-N,6-N-bis(3-methyl-5-propan-2-ylphenyl)-6-N,9,10-triphenylanthracene-2,6-diamine.
| Compound Name | 2-N-(4-methylphenyl)-2-N,6-N-bis(3-methyl-5-propan-2-ylphenyl)-6-N,9,10-triphenylanthracene-2,6-diamine |
|---|---|
| PubChem CID | 143986348 |
| Molecular Formula | C59H54N2 |
| Molecular Weight | 791.10 g/mol |
| Exact Mass | 790.43 |
| IUPAC Name | 2-N-(4-methylphenyl)-2-N,6-N-bis(3-methyl-5-propan-2-ylphenyl)-6-N,9,10-triphenylanthracene-2,6-diamine |
| SMILES | Cc1ccc(N(c2cc(C)cc(C(C)C)c2)c2ccc3c(-c4ccccc4)c4cc(N(c5ccccc5)c5cc(C)cc(C(C)C)c5)ccc4c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C59H54N2/c1-39(2)46-31-42(6)33-52(35-46)60(48-21-15-10-16-22-48)50-27-29-54-56(37-50)58(44-17-11-8-12-18-44)55-30-28-51(38-57(55)59(54)45-19-13-9-14-20-45)61(49-25-23-41(5)24-26-49)53-34-43(7)32-47(36-53)40(3)4/h8-40H,1-7H3 |
| InChIKey | XATIRTXIDZFVHW-UHFFFAOYSA-N |
| XLogP | 17.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.10 |
| LogP ≤ 5 | 17.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|