About methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene
methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene (PubChem CID 143987019) has the molecular formula C17H21F3O4S
and a molecular weight of 378.41 g/mol. Its IUPAC name is methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene |
| PubChem CID | 143987019 |
| Molecular Formula | C17H21F3O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene |
| SMILES | COC(=O)C1=C(C)CCCC1.CS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H14O2.C8H7F3O2S/c1-7-5-3-4-6-8(7)9(10)11-2;1-14(12,13)7-4-2-3-6(5-7)8(9,10)11/h3-6H2,1-2H3;2-5H,1H3 |
| InChIKey | VZCLIIRVPMUTIT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene?
The IUPAC name of methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene (CID 143987019) is methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene.
What is the SMILES notation for methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene?
The canonical SMILES for methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene is COC(=O)C1=C(C)CCCC1.CS(=O)(=O)c1cccc(C(F)(F)F)c1.
What is the InChIKey of methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene?
The InChIKey is VZCLIIRVPMUTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.C8H7F3O2S/c1-7-5-3-4-6-8(7)9(10)11-2;1-14(12,13)7-4-2-3-6(5-7)8(9,10)11/h3-6H2,1-2H3;2-5H,1H3.
What are the key properties of methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene?
methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene has a molecular weight of 378.41 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylcyclohexene-1-carboxylate;1-methylsulfonyl-3-(trifluoromethyl)benzene is sourced from PubChem (CID 143987019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).