C20H27N5O4 — CID 143987096
1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]methyl]-3-piperidin-4-ylurea (PubChem CID 143987096) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]methyl]-3-piperidin-4-ylurea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]methyl]-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 143987096 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]methyl]-3-piperidin-4-ylurea |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)NC4CCNCC4)ccc3C2O)C(=O)N1 |
| InChI | InChI=1S/C20H27N5O4/c26-17-4-3-16(18(27)24-17)25-11-13-9-12(1-2-15(13)19(25)28)10-22-20(29)23-14-5-7-21-8-6-14/h1-2,9,14,16,19,21,28H,3-8,10-11H2,(H2,22,23,29)(H,24,26,27) |
| InChIKey | UPUAWTYGGKCUCX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|